C23H21ClN2O4 — CID 110583659
3-chloro-4-(3,4-dimethoxyphenyl)-1-[2-(1-methylindol-3-yl)ethyl]pyrrole-2,5-dione (PubChem CID 110583659) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)-1-[2-(1-methylindol-3-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-[2-(1-methylindol-3-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583659 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)-1-[2-(1-methylindol-3-yl)ethyl]pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Cl)C(=O)N(CCc3cn(C)c4ccccc34)C2=O)cc1OC |
| InChI | InChI=1S/C23H21ClN2O4/c1-25-13-15(16-6-4-5-7-17(16)25)10-11-26-22(27)20(21(24)23(26)28)14-8-9-18(29-2)19(12-14)30-3/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | CGJDPUFRRLGJMC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|