C22H30ClNO2 — CID 110582133
3-chloro-1-decyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110582133) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is 3-chloro-1-decyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-decyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582133 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-chloro-1-decyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCCCCCCCN1C(=O)C(Cl)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C22H30ClNO2/c1-4-5-6-7-8-9-10-11-14-24-21(25)19(20(23)22(24)26)18-13-12-16(2)17(3)15-18/h12-13,15H,4-11,14H2,1-3H3 |
| InChIKey | FFDJGVMXRVMPGK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|