C23H33N3O2 — CID 110548777
3-(3,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)-1-pentylpyrrole-2,5-dione (PubChem CID 110548777) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548777 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(c2ccc(C)c(C)c2)=C(N2CCN(CC)CC2)C1=O |
| InChI | InChI=1S/C23H33N3O2/c1-5-7-8-11-26-22(27)20(19-10-9-17(3)18(4)16-19)21(23(26)28)25-14-12-24(6-2)13-15-25/h9-10,16H,5-8,11-15H2,1-4H3 |
| InChIKey | FFHCFGPVLPJLHI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|