C20H26ClNO2 — CID 110582139
3-chloro-4-(3,4-dimethylphenyl)-1-octylpyrrole-2,5-dione (PubChem CID 110582139) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethylphenyl)-1-octylpyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethylphenyl)-1-octylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582139 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-chloro-4-(3,4-dimethylphenyl)-1-octylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(Cl)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C20H26ClNO2/c1-4-5-6-7-8-9-12-22-19(23)17(18(21)20(22)24)16-11-10-14(2)15(3)13-16/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | KVIOBCRSCBNQDQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|