C24H27NO2S — CID 110549362
3-(3,4-dimethylphenyl)-1-hexyl-4-phenylsulfanylpyrrole-2,5-dione (PubChem CID 110549362) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-hexyl-4-phenylsulfanylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-1-hexyl-4-phenylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549362 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-hexyl-4-phenylsulfanylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(Sc2ccccc2)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C24H27NO2S/c1-4-5-6-10-15-25-23(26)21(19-14-13-17(2)18(3)16-19)22(24(25)27)28-20-11-8-7-9-12-20/h7-9,11-14,16H,4-6,10,15H2,1-3H3 |
| InChIKey | MMWHETPMKMFYQZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|