C22H22ClNO3 — CID 110582140
3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110582140) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582140 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(OCCN2C(=O)C(Cl)=C(c3ccc(C)c(C)c3)C2=O)c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-13-9-14(2)11-18(10-13)27-8-7-24-21(25)19(20(23)22(24)26)17-6-5-15(3)16(4)12-17/h5-6,9-12H,7-8H2,1-4H3 |
| InChIKey | RXMGFWPKNCPKEP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|