C23H25NO5 — CID 110582405
1-[2-(3,5-dimethylphenoxy)ethyl]-3-hydroxy-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110582405) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-3-hydroxy-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-hydroxy-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582405 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-hydroxy-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(O)C(=O)N(CCOc3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-4-10-28-18-7-5-17(6-8-18)20-21(25)23(27)24(22(20)26)9-11-29-19-13-15(2)12-16(3)14-19/h5-8,12-14,25H,4,9-11H2,1-3H3 |
| InChIKey | WPFMTHQJXIQDSD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|