C22H22ClNO4 — CID 110581087
3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110581087) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581087 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-chloro-1-[2-(3,5-dimethylphenoxy)ethyl]-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Cl)C(=O)N(CCOc3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H22ClNO4/c1-4-27-17-7-5-16(6-8-17)19-20(23)22(26)24(21(19)25)9-10-28-18-12-14(2)11-15(3)13-18/h5-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | TWINXOVKGRAGIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|