C24H34N2O5 — CID 110564491
3-(3,4-dimethoxyphenyl)-1-hexyl-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione (PubChem CID 110564491) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-hexyl-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-hexyl-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564491 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-hexyl-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(OC)c(OC)c2)=C(N2CCCC(CO)C2)C1=O |
| InChI | InChI=1S/C24H34N2O5/c1-4-5-6-7-13-26-23(28)21(18-10-11-19(30-2)20(14-18)31-3)22(24(26)29)25-12-8-9-17(15-25)16-27/h10-11,14,17,27H,4-9,12-13,15-16H2,1-3H3 |
| InChIKey | ABFPUDZIYJXCEE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|