C20H26N2O4 — CID 110556296
3-[3-(hydroxymethyl)piperidin-1-yl]-4-(4-methoxyphenyl)-1-propylpyrrole-2,5-dione (PubChem CID 110556296) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(4-methoxyphenyl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(4-methoxyphenyl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556296 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(4-methoxyphenyl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccc(OC)cc2)=C(N2CCCC(CO)C2)C1=O |
| InChI | InChI=1S/C20H26N2O4/c1-3-10-22-19(24)17(15-6-8-16(26-2)9-7-15)18(20(22)25)21-11-4-5-14(12-21)13-23/h6-9,14,23H,3-5,10-13H2,1-2H3 |
| InChIKey | RCDMSJDQBCRQPK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|