C25H28N2O5 — CID 110565089
3-(3,4-dimethoxyphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(2-methylphenyl)pyrrole-2,5-dione (PubChem CID 110565089) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(2-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(2-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110565089 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(2-methylphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCCC(CO)C3)C(=O)N(c3ccccc3C)C2=O)cc1OC |
| InChI | InChI=1S/C25H28N2O5/c1-16-7-4-5-9-19(16)27-24(29)22(18-10-11-20(31-2)21(13-18)32-3)23(25(27)30)26-12-6-8-17(14-26)15-28/h4-5,7,9-11,13,17,28H,6,8,12,14-15H2,1-3H3 |
| InChIKey | MVOUWNOVBKUNGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|