C27H26N2O4 — CID 110567350
3-[3-(hydroxymethyl)piperidin-1-yl]-4-(2-methoxyphenyl)-1-naphthalen-1-ylpyrrole-2,5-dione (PubChem CID 110567350) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(2-methoxyphenyl)-1-naphthalen-1-ylpyrrole-2,5-dione.
| Compound Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(2-methoxyphenyl)-1-naphthalen-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110567350 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-4-(2-methoxyphenyl)-1-naphthalen-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(N2CCCC(CO)C2)C(=O)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C27H26N2O4/c1-33-23-14-5-4-12-21(23)24-25(28-15-7-8-18(16-28)17-30)27(32)29(26(24)31)22-13-6-10-19-9-2-3-11-20(19)22/h2-6,9-14,18,30H,7-8,15-17H2,1H3 |
| InChIKey | QVZFPYARAZJXMU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|