C24H20FNO5S — CID 110564436
3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110564436) has the molecular formula C24H20FNO5S and a molecular weight of 453.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564436 |
| Molecular Formula | C24H20FNO5S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(SCc3ccco3)C(=O)N(Cc3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C24H20FNO5S/c1-29-19-10-9-15(12-20(19)30-2)21-22(32-14-17-7-5-11-31-17)24(28)26(23(21)27)13-16-6-3-4-8-18(16)25/h3-12H,13-14H2,1-2H3 |
| InChIKey | PAWFHOCLPIEQDH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|