C20H15FN2OS — CID 1283764
4-(4-fluorophenyl)-3-(furan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 1283764) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-(furan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-fluorophenyl)-3-(furan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 1283764 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-(4-fluorophenyl)-3-(furan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(-c2cs/c(=N\c3ccccc3)n2Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H15FN2OS/c21-16-10-8-15(9-11-16)19-14-25-20(22-17-5-2-1-3-6-17)23(19)13-18-7-4-12-24-18/h1-12,14H,13H2/b22-20- |
| InChIKey | ZFJOWAPNGGBRJA-XDOYNYLZSA-N |
| XLogP | 5.23 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|