C23H20ClFN2O4S — CID 23857350
N-(4-chloro-3-fluorophenyl)-3-(furan-2-ylmethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23857350) has the molecular formula C23H20ClFN2O4S and a molecular weight of 474.94 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-3-(furan-2-ylmethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-chloro-3-fluorophenyl)-3-(furan-2-ylmethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23857350 |
| Molecular Formula | C23H20ClFN2O4S |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-3-(furan-2-ylmethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\c3ccc(Cl)c(F)c3)n2Cc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20ClFN2O4S/c1-28-20-9-14(10-21(29-2)22(20)30-3)19-13-32-23(27(19)12-16-5-4-8-31-16)26-15-6-7-17(24)18(25)11-15/h4-11,13H,12H2,1-3H3/b26-23- |
| InChIKey | KYYXPCMFKSTLJM-RWEWTDSWSA-N |
| XLogP | 5.91 |
| TPSA | 58.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|