C33H24N6O2S — CID 46895662
4-cyano-N-[(E)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-1,5-diphenylpyrazole-3-carboxamide (PubChem CID 46895662) has the molecular formula C33H24N6O2S and a molecular weight of 568.66 g/mol. Its IUPAC name is 4-cyano-N-[(E)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-1,5-diphenylpyrazole-3-carboxamide.
| Compound Name | 4-cyano-N-[(E)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-1,5-diphenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46895662 |
| Molecular Formula | C33H24N6O2S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 4-cyano-N-[(E)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-1,5-diphenylpyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cs/c(=N/NC(=O)c3nn(-c4ccccc4)c(-c4ccccc4)c3C#N)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24N6O2S/c1-41-27-19-17-23(18-20-27)29-22-42-33(38(29)25-13-7-3-8-14-25)36-35-32(40)30-28(21-34)31(24-11-5-2-6-12-24)39(37-30)26-15-9-4-10-16-26/h2-20,22H,1H3,(H,35,40)/b36-33+ |
| InChIKey | ASMMYFDRHNNWGB-PKUSAGTQSA-N |
| XLogP | 6.18 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|