C32H22N6OS — CID 46895660
4-cyano-N-[(E)-(3,4-diphenyl-1,3-thiazol-2-ylidene)amino]-1,5-diphenylpyrazole-3-carboxamide (PubChem CID 46895660) has the molecular formula C32H22N6OS and a molecular weight of 538.64 g/mol. Its IUPAC name is 4-cyano-N-[(E)-(3,4-diphenyl-1,3-thiazol-2-ylidene)amino]-1,5-diphenylpyrazole-3-carboxamide.
| Compound Name | 4-cyano-N-[(E)-(3,4-diphenyl-1,3-thiazol-2-ylidene)amino]-1,5-diphenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46895660 |
| Molecular Formula | C32H22N6OS |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4-cyano-N-[(E)-(3,4-diphenyl-1,3-thiazol-2-ylidene)amino]-1,5-diphenylpyrazole-3-carboxamide |
| SMILES | N#Cc1c(C(=O)N/N=c2/scc(-c3ccccc3)n2-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H22N6OS/c33-21-27-29(36-38(26-19-11-4-12-20-26)30(27)24-15-7-2-8-16-24)31(39)34-35-32-37(25-17-9-3-10-18-25)28(22-40-32)23-13-5-1-6-14-23/h1-20,22H,(H,34,39)/b35-32+ |
| InChIKey | DVOMTGYZUCNKHA-LVYIWIAJSA-N |
| XLogP | 6.18 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|