C22H17N5O2S — CID 11258522
methyl 4-[4-phenyl-2-(pyrazine-2-carboximidoylimino)-1,3-thiazol-3-yl]benzoate (PubChem CID 11258522) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is methyl 4-[4-phenyl-2-(pyrazine-2-carboximidoylimino)-1,3-thiazol-3-yl]benzoate.
| Compound Name | methyl 4-[4-phenyl-2-(pyrazine-2-carboximidoylimino)-1,3-thiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 11258522 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 4-[4-phenyl-2-(pyrazine-2-carboximidoylimino)-1,3-thiazol-3-yl]benzoate |
| SMILES | [H]/N=C(/N=c1\scc(-c2ccccc2)n1-c1ccc(C(=O)OC)cc1)c1cnccn1 |
| InChI | InChI=1S/C22H17N5O2S/c1-29-21(28)16-7-9-17(10-8-16)27-19(15-5-3-2-4-6-15)14-30-22(27)26-20(23)18-13-24-11-12-25-18/h2-14,23H,1H3/b23-20+,26-22- |
| InChIKey | NNJNCWKPMZRTKG-KZEIHBSTSA-N |
| XLogP | 3.71 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|