C30H33N3O4S2 — CID 18812995
N,3-bis(4-ethoxyphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 18812995) has the molecular formula C30H33N3O4S2 and a molecular weight of 563.75 g/mol. Its IUPAC name is N,3-bis(4-ethoxyphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N,3-bis(4-ethoxyphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18812995 |
| Molecular Formula | C30H33N3O4S2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | N,3-bis(4-ethoxyphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)n2-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C30H33N3O4S2/c1-3-36-26-14-10-24(11-15-26)31-30-33(25-12-16-27(17-13-25)37-4-2)29(22-38-30)23-8-18-28(19-9-23)39(34,35)32-20-6-5-7-21-32/h8-19,22H,3-7,20-21H2,1-2H3/b31-30- |
| InChIKey | LMWHQVYUFYLUTM-KTMFPKCZSA-N |
| XLogP | 6.41 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|