C22H26BrN3O2S — CID 142106126
ethane;methyl N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]carbamate (PubChem CID 142106126) has the molecular formula C22H26BrN3O2S and a molecular weight of 476.44 g/mol. Its IUPAC name is ethane;methyl N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]carbamate.
| Compound Name | ethane;methyl N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142106126 |
| Molecular Formula | C22H26BrN3O2S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | ethane;methyl N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]carbamate |
| SMILES | CC.COC(=O)NCCCn1c(-c2ccc(Br)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C20H20BrN3O2S.C2H6/c1-26-20(25)22-12-5-13-24-18(15-8-10-16(21)11-9-15)14-27-19(24)23-17-6-3-2-4-7-17;1-2/h2-4,6-11,14H,5,12-13H2,1H3,(H,22,25);1-2H3/b23-19-; |
| InChIKey | GWJMWLBRJOREBI-PDEWKSAASA-N |
| XLogP | 5.98 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|