C21H20N4OS — CID 146088039
N-[3-[4-(4-cyanophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]acetamide (PubChem CID 146088039) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is N-[3-[4-(4-cyanophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(4-cyanophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 146088039 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[3-[4-(4-cyanophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCn1c(-c2ccc(C#N)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C21H20N4OS/c1-16(26)23-12-5-13-25-20(18-10-8-17(14-22)9-11-18)15-27-21(25)24-19-6-3-2-4-7-19/h2-4,6-11,15H,5,12-13H2,1H3,(H,23,26)/b24-21- |
| InChIKey | APZDLNHZVSDTBZ-FLFQWRMESA-N |
| XLogP | 3.85 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|