C24H27N3O3S — CID 146087542
N-[4-[3-[2-(oxolan-3-ylmethoxy)ethyl]-2-phenylimino-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 146087542) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[4-[3-[2-(oxolan-3-ylmethoxy)ethyl]-2-phenylimino-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[2-(oxolan-3-ylmethoxy)ethyl]-2-phenylimino-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 146087542 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[4-[3-[2-(oxolan-3-ylmethoxy)ethyl]-2-phenylimino-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cs/c(=N\c3ccccc3)n2CCOCC2CCOC2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-18(28)25-22-9-7-20(8-10-22)23-17-31-24(26-21-5-3-2-4-6-21)27(23)12-14-30-16-19-11-13-29-15-19/h2-10,17,19H,11-16H2,1H3,(H,25,28)/b26-24- |
| InChIKey | ZLEKLSSHXCHELK-LCUIJRPUSA-N |
| XLogP | 4.46 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|