C18H15N5O5S — CID 6218688
2-hydroxy-5-[3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-prop-2-enylimino-1,3-thiazol-4-yl]benzamide (PubChem CID 6218688) has the molecular formula C18H15N5O5S and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-prop-2-enylimino-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-hydroxy-5-[3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-prop-2-enylimino-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 6218688 |
| Molecular Formula | C18H15N5O5S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-hydroxy-5-[3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-prop-2-enylimino-1,3-thiazol-4-yl]benzamide |
| SMILES | C=CC/N=c1\scc(-c2ccc(O)c(C(N)=O)c2)n1/N=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H15N5O5S/c1-2-7-20-18-22(21-9-12-4-6-16(28-12)23(26)27)14(10-29-18)11-3-5-15(24)13(8-11)17(19)25/h2-6,8-10,24H,1,7H2,(H2,19,25)/b20-18-,21-9- |
| InChIKey | LXGDTXVREDAZNB-BTGOFOGLSA-N |
| XLogP | 2.49 |
| TPSA | 149.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|