C23H20BrN3O3S — CID 135718881
2-bromo-4-[[4-(furan-2-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135718881) has the molecular formula C23H20BrN3O3S and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-bromo-4-[[4-(furan-2-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[4-(furan-2-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135718881 |
| Molecular Formula | C23H20BrN3O3S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 2-bromo-4-[[4-(furan-2-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(C=Nn2c(-c3ccco3)cs/c2=N\CCc2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C23H20BrN3O3S/c1-29-21-13-17(12-18(24)22(21)28)14-26-27-19(20-8-5-11-30-20)15-31-23(27)25-10-9-16-6-3-2-4-7-16/h2-8,11-15,28H,9-10H2,1H3/b25-23-,26-14? |
| InChIKey | WACKJQUKUARVOO-REWQIIKUSA-N |
| XLogP | 5.31 |
| TPSA | 72.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|