C22H19N5O2S — CID 135582135
3-[(2-methyl-1H-indol-3-yl)methylideneamino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 135582135) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-[(2-methyl-1H-indol-3-yl)methylideneamino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 3-[(2-methyl-1H-indol-3-yl)methylideneamino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135582135 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[(2-methyl-1H-indol-3-yl)methylideneamino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc([N+](=O)[O-])c2)n1N=Cc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19N5O2S/c1-3-11-23-22-26(21(14-30-22)16-7-6-8-17(12-16)27(28)29)24-13-19-15(2)25-20-10-5-4-9-18(19)20/h3-10,12-14,25H,1,11H2,2H3/b23-22-,24-13? |
| InChIKey | RAVIRIOFGGIIFF-NEKVQCKSSA-N |
| XLogP | 4.88 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|