C21H17BrN4O2S — CID 6906027
(E)-4-(3-bromophenyl)-3-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 6906027) has the molecular formula C21H17BrN4O2S and a molecular weight of 469.36 g/mol. Its IUPAC name is (E)-4-(3-bromophenyl)-3-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | (E)-4-(3-bromophenyl)-3-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6906027 |
| Molecular Formula | C21H17BrN4O2S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | (E)-4-(3-bromophenyl)-3-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc(Br)c2)n1/N=C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17BrN4O2S/c1-2-12-23-21-25(20(15-29-21)17-8-5-10-18(22)14-17)24-13-6-9-16-7-3-4-11-19(16)26(27)28/h2-11,13-15H,1,12H2/b9-6+,23-21-,24-13+ |
| InChIKey | HHPCFBFOLYYCDN-ZGOGHQJLSA-N |
| XLogP | 5.52 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|