C22H22BrN3O3S — CID 23795570
4-(3-bromophenyl)-N-prop-2-enyl-3-[(2,4,6-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23795570) has the molecular formula C22H22BrN3O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is 4-(3-bromophenyl)-N-prop-2-enyl-3-[(2,4,6-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(3-bromophenyl)-N-prop-2-enyl-3-[(2,4,6-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23795570 |
| Molecular Formula | C22H22BrN3O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 4-(3-bromophenyl)-N-prop-2-enyl-3-[(2,4,6-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc(Br)c2)n1N=Cc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C22H22BrN3O3S/c1-5-9-24-22-26(19(14-30-22)15-7-6-8-16(23)10-15)25-13-18-20(28-3)11-17(27-2)12-21(18)29-4/h5-8,10-14H,1,9H2,2-4H3/b24-22-,25-13? |
| InChIKey | KIMRJIPXZXCTPP-ZJDDHNLJSA-N |
| XLogP | 4.97 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|