C23H30N4O2S — CID 23736445
3-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23736445) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 3-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 3-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736445 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]-4-(3-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccc([N+](=O)[O-])c2)n1N=C1CCC(C(C)(C)CC)CC1 |
| InChI | InChI=1S/C23H30N4O2S/c1-5-14-24-22-26(25-19-12-10-18(11-13-19)23(3,4)6-2)21(16-30-22)17-8-7-9-20(15-17)27(28)29/h5,7-9,15-16,18H,1,6,10-14H2,2-4H3/b24-22-,25-19- |
| InChIKey | OODKFHCPKFBHKE-JVPUZYLPSA-N |
| XLogP | 6.04 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|