C27H22F2N4O2S — CID 23819153
N-(2,4-difluorophenyl)-4-(3-nitrophenyl)-3-[(4-phenylcyclohexylidene)amino]-1,3-thiazol-2-imine (PubChem CID 23819153) has the molecular formula C27H22F2N4O2S and a molecular weight of 504.56 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(3-nitrophenyl)-3-[(4-phenylcyclohexylidene)amino]-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-difluorophenyl)-4-(3-nitrophenyl)-3-[(4-phenylcyclohexylidene)amino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23819153 |
| Molecular Formula | C27H22F2N4O2S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(3-nitrophenyl)-3-[(4-phenylcyclohexylidene)amino]-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cccc(-c2cs/c(=N\c3ccc(F)cc3F)n2N=C2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H22F2N4O2S/c28-21-11-14-25(24(29)16-21)30-27-32(26(17-36-27)20-7-4-8-23(15-20)33(34)35)31-22-12-9-19(10-13-22)18-5-2-1-3-6-18/h1-8,11,14-17,19H,9-10,12-13H2/b30-27-,31-22- |
| InChIKey | BBYTUIFRDMISPY-ZQLHPYLPSA-N |
| XLogP | 7.20 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|