C23H22Cl2N4O2S — CID 23989799
3-(cyclooctylideneamino)-4-(2,5-dichlorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23989799) has the molecular formula C23H22Cl2N4O2S and a molecular weight of 489.43 g/mol. Its IUPAC name is 3-(cyclooctylideneamino)-4-(2,5-dichlorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclooctylideneamino)-4-(2,5-dichlorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23989799 |
| Molecular Formula | C23H22Cl2N4O2S |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 3-(cyclooctylideneamino)-4-(2,5-dichlorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2cc(Cl)ccc2Cl)n1N=C1CCCCCCC1 |
| InChI | InChI=1S/C23H22Cl2N4O2S/c24-16-12-13-19(25)18(14-16)22-15-32-23(26-20-10-6-7-11-21(20)29(30)31)28(22)27-17-8-4-2-1-3-5-9-17/h6-7,10-15H,1-5,8-9H2/b26-23- |
| InChIKey | MSQXKYWJVPXOIY-RWEWTDSWSA-N |
| XLogP | 7.61 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|