C25H19FN4O2S — CID 23875356
3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(2-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23875356) has the molecular formula C25H19FN4O2S and a molecular weight of 458.52 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(2-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(2-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23875356 |
| Molecular Formula | C25H19FN4O2S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-4-(2-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2ccccc2F)n1N=C1CCCc2ccccc21 |
| InChI | InChI=1S/C25H19FN4O2S/c26-20-12-4-3-11-19(20)24-16-33-25(27-22-13-5-6-15-23(22)30(31)32)29(24)28-21-14-7-9-17-8-1-2-10-18(17)21/h1-6,8,10-13,15-16H,7,9,14H2/b27-25-,28-21? |
| InChIKey | AVYHPNHDONGBKW-NRLRZIAOSA-N |
| XLogP | 6.09 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|