C21H20FN3O2S — CID 23912390
3-cyclohexyl-4-(4-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23912390) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-cyclohexyl-4-(4-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-cyclohexyl-4-(4-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23912390 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-cyclohexyl-4-(4-fluorophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2ccc(F)cc2)n1C1CCCCC1 |
| InChI | InChI=1S/C21H20FN3O2S/c22-16-12-10-15(11-13-16)20-14-28-21(24(20)17-6-2-1-3-7-17)23-18-8-4-5-9-19(18)25(26)27/h4-5,8-14,17H,1-3,6-7H2/b23-21- |
| InChIKey | UNDUHBCIHGHHAL-LNVKXUELSA-N |
| XLogP | 6.00 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|