C18H14F2N2S — CID 23994989
3-cyclopropyl-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 23994989) has the molecular formula C18H14F2N2S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-cyclopropyl-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-cyclopropyl-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23994989 |
| Molecular Formula | C18H14F2N2S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-cyclopropyl-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccc(F)cc3)n2C2CC2)cc1 |
| InChI | InChI=1S/C18H14F2N2S/c19-13-3-1-12(2-4-13)17-11-23-18(22(17)16-9-10-16)21-15-7-5-14(20)6-8-15/h1-8,11,16H,9-10H2/b21-18- |
| InChIKey | MHXXXIPNSCDCQE-UZYVYHOESA-N |
| XLogP | 5.06 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|