C20H20N2S — CID 23765123
3-cyclopropyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 23765123) has the molecular formula C20H20N2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-cyclopropyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-cyclopropyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23765123 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-cyclopropyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2\scc(-c3ccc(C)cc3)n2C2CC2)cc1 |
| InChI | InChI=1S/C20H20N2S/c1-14-3-7-16(8-4-14)19-13-23-20(22(19)18-11-12-18)21-17-9-5-15(2)6-10-17/h3-10,13,18H,11-12H2,1-2H3/b21-20- |
| InChIKey | PREHFLMMDGAYLZ-MRCUWXFGSA-N |
| XLogP | 5.40 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|