C21H24N2S — CID 18813263
3-tert-butyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 18813263) has the molecular formula C21H24N2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 3-tert-butyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-tert-butyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813263 |
| Molecular Formula | C21H24N2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-tert-butyl-N,4-bis(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2\scc(-c3ccc(C)cc3)n2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24N2S/c1-15-6-10-17(11-7-15)19-14-24-20(23(19)21(3,4)5)22-18-12-8-16(2)9-13-18/h6-14H,1-5H3/b22-20- |
| InChIKey | KJAIBURQGODITG-XDOYNYLZSA-N |
| XLogP | 5.82 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |