C16H12F2N2S — CID 142106070
N,4-bis(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine (PubChem CID 142106070) has the molecular formula C16H12F2N2S and a molecular weight of 302.35 g/mol. Its IUPAC name is N,4-bis(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine.
| Compound Name | N,4-bis(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 142106070 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N,4-bis(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine |
| SMILES | Cn1c(-c2ccc(F)cc2)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12F2N2S/c1-20-15(11-2-4-12(17)5-3-11)10-21-16(20)19-14-8-6-13(18)7-9-14/h2-10H,1H3/b19-16- |
| InChIKey | STXHNSADBOXHJN-MNDPQUGUSA-N |
| XLogP | 4.26 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|