C17H15BrN2OS — CID 1371436
4-(4-bromophenyl)-N-(3-methoxyphenyl)-3-methyl-1,3-thiazol-2-imine (PubChem CID 1371436) has the molecular formula C17H15BrN2OS and a molecular weight of 375.29 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(3-methoxyphenyl)-3-methyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-N-(3-methoxyphenyl)-3-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 1371436 |
| Molecular Formula | C17H15BrN2OS |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 4-(4-bromophenyl)-N-(3-methoxyphenyl)-3-methyl-1,3-thiazol-2-imine |
| SMILES | COc1cccc(/N=c2\scc(-c3ccc(Br)cc3)n2C)c1 |
| InChI | InChI=1S/C17H15BrN2OS/c1-20-16(12-6-8-13(18)9-7-12)11-22-17(20)19-14-4-3-5-15(10-14)21-2/h3-11H,1-2H3/b19-17- |
| InChIKey | HDAXEWVUEVJROP-ZPHPHTNESA-N |
| XLogP | 4.76 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|