C16H13Br2FN2S — CID 2886991
4-(4-bromophenyl)-N-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 2886991) has the molecular formula C16H13Br2FN2S and a molecular weight of 444.17 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 4-(4-bromophenyl)-N-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 2886991 |
| Molecular Formula | C16H13Br2FN2S |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 441.92 |
| IUPAC Name | 4-(4-bromophenyl)-N-(4-fluorophenyl)-3-methyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.Cn1c(-c2ccc(Br)cc2)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12BrFN2S.BrH/c1-20-15(11-2-4-12(17)5-3-11)10-21-16(20)19-14-8-6-13(18)7-9-14;/h2-10H,1H3;1H/b19-16-; |
| InChIKey | XKGRYYBUGQLWEU-JWJVXZKMSA-N |
| XLogP | 5.47 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|