C32H26N4O2S3 — CID 122373825
3-methyl-N-[4-[4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]phenyl]sulfonylphenyl]-4-phenyl-1,3-thiazol-2-imine (PubChem CID 122373825) has the molecular formula C32H26N4O2S3 and a molecular weight of 594.79 g/mol. Its IUPAC name is 3-methyl-N-[4-[4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]phenyl]sulfonylphenyl]-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-methyl-N-[4-[4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]phenyl]sulfonylphenyl]-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 122373825 |
| Molecular Formula | C32H26N4O2S3 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 3-methyl-N-[4-[4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]phenyl]sulfonylphenyl]-4-phenyl-1,3-thiazol-2-imine |
| SMILES | Cn1c(-c2ccccc2)cs/c1=N\c1ccc(S(=O)(=O)c2ccc(/N=c3/scc(-c4ccccc4)n3C)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O2S3/c1-35-29(23-9-5-3-6-10-23)21-39-31(35)33-25-13-17-27(18-14-25)41(37,38)28-19-15-26(16-20-28)34-32-36(2)30(22-40-32)24-11-7-4-8-12-24/h3-22H,1-2H3/b33-31-,34-32+ |
| InChIKey | FKDYUSUSHDIYQO-IUQQBYGBSA-N |
| XLogP | 7.12 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|