C17H17BrClN3O2S2 — CID 20527344
4-chloro-N-methyl-3-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrobromide (PubChem CID 20527344) has the molecular formula C17H17BrClN3O2S2 and a molecular weight of 474.83 g/mol. Its IUPAC name is 4-chloro-N-methyl-3-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrobromide.
| Compound Name | 4-chloro-N-methyl-3-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrobromide |
|---|---|
| PubChem CID | 20527344 |
| Molecular Formula | C17H17BrClN3O2S2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 4-chloro-N-methyl-3-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrobromide |
| SMILES | Br.CNS(=O)(=O)c1ccc(Cl)c(-c2cs/c(=N\c3ccccc3)n2C)c1 |
| InChI | InChI=1S/C17H16ClN3O2S2.BrH/c1-19-25(22,23)13-8-9-15(18)14(10-13)16-11-24-17(21(16)2)20-12-6-4-3-5-7-12;/h3-11,19H,1-2H3;1H/b20-17-; |
| InChIKey | OHKNVJIHERJQTG-BZHDPTRRSA-N |
| XLogP | 4.13 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|