C8H10ClNO2S — CID 50876568
4-chloro-N,3-dimethylbenzenesulfonamide (PubChem CID 50876568) has the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. Its IUPAC name is 4-chloro-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 50876568 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 4-chloro-N,3-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C8H10ClNO2S/c1-6-5-7(3-4-8(6)9)13(11,12)10-2/h3-5,10H,1-2H3 |
| InChIKey | AHVAJUFYDKIYFI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |