C8H12N2O4S2 — CID 162500455
4-N,2-dimethylbenzene-1,4-disulfonamide (PubChem CID 162500455) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-N,2-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 4-N,2-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 162500455 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-N,2-dimethylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C8H12N2O4S2/c1-6-5-7(16(13,14)10-2)3-4-8(6)15(9,11)12/h3-5,10H,1-2H3,(H2,9,11,12) |
| InChIKey | WUACGCAMPBPAFL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |