C8H10INO2S — CID 2817416
3-iodo-N,4-dimethylbenzenesulfonamide (PubChem CID 2817416) has the molecular formula C8H10INO2S and a molecular weight of 311.14 g/mol. Its IUPAC name is 3-iodo-N,4-dimethylbenzenesulfonamide.
| Compound Name | 3-iodo-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2817416 |
| Molecular Formula | C8H10INO2S |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 3-iodo-N,4-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(I)c1 |
| InChI | InChI=1S/C8H10INO2S/c1-6-3-4-7(5-8(6)9)13(11,12)10-2/h3-5,10H,1-2H3 |
| InChIKey | HNLVSPQZHRIBQB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|