C13H22N2O2S — CID 43752081
N,4-dimethyl-3-(3-methylbutan-2-ylamino)benzenesulfonamide (PubChem CID 43752081) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N,4-dimethyl-3-(3-methylbutan-2-ylamino)benzenesulfonamide.
| Compound Name | N,4-dimethyl-3-(3-methylbutan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43752081 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N,4-dimethyl-3-(3-methylbutan-2-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(NC(C)C(C)C)c1 |
| InChI | InChI=1S/C13H22N2O2S/c1-9(2)11(4)15-13-8-12(7-6-10(13)3)18(16,17)14-5/h6-9,11,14-15H,1-5H3 |
| InChIKey | PACYYPBHIGUARX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |