C14H22BNO4S — CID 75486975
N,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 75486975) has the molecular formula C14H22BNO4S and a molecular weight of 311.21 g/mol. Its IUPAC name is N,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75486975 |
| Molecular Formula | C14H22BNO4S |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H22BNO4S/c1-10-7-8-11(21(17,18)16-6)9-12(10)15-19-13(2,3)14(4,5)20-15/h7-9,16H,1-6H3 |
| InChIKey | KZQGHOMIBYNIEB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|