C21H25Cl2N3O2S2 — CID 20527297
N-butyl-2-chloro-N-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 20527297) has the molecular formula C21H25Cl2N3O2S2 and a molecular weight of 486.49 g/mol. Its IUPAC name is N-butyl-2-chloro-N-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | N-butyl-2-chloro-N-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 20527297 |
| Molecular Formula | C21H25Cl2N3O2S2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-butyl-2-chloro-N-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | CCCCN(C)S(=O)(=O)c1cc(-c2cs/c(=N\c3ccccc3)n2C)ccc1Cl.Cl |
| InChI | InChI=1S/C21H24ClN3O2S2.ClH/c1-4-5-13-24(2)29(26,27)20-14-16(11-12-18(20)22)19-15-28-21(25(19)3)23-17-9-7-6-8-10-17;/h6-12,14-15H,4-5,13H2,1-3H3;1H/b23-21-; |
| InChIKey | ZBCIIVYYHTUCMX-VZXGSGAOSA-N |
| XLogP | 5.48 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|