C21H22ClN3O2S2 — CID 122185235
4-[[4-(4-chlorophenyl)-3-cyclohexyl-1,3-thiazol-2-ylidene]amino]benzenesulfonamide (PubChem CID 122185235) has the molecular formula C21H22ClN3O2S2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-3-cyclohexyl-1,3-thiazol-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(4-chlorophenyl)-3-cyclohexyl-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 122185235 |
| Molecular Formula | C21H22ClN3O2S2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-3-cyclohexyl-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=c2\scc(-c3ccc(Cl)cc3)n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H22ClN3O2S2/c22-16-8-6-15(7-9-16)20-14-28-21(25(20)18-4-2-1-3-5-18)24-17-10-12-19(13-11-17)29(23,26)27/h6-14,18H,1-5H2,(H2,23,26,27)/b24-21- |
| InChIKey | QLFZIGDAGVQUNR-FLFQWRMESA-N |
| XLogP | 5.26 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|