C18H18ClN3O2S2 — CID 20527108
2-chloro-N-ethyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide (PubChem CID 20527108) has the molecular formula C18H18ClN3O2S2 and a molecular weight of 407.95 g/mol. Its IUPAC name is 2-chloro-N-ethyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-ethyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20527108 |
| Molecular Formula | C18H18ClN3O2S2 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-chloro-N-ethyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1cc(-c2cs/c(=N\c3ccccc3)n2C)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O2S2/c1-3-20-26(23,24)17-11-13(9-10-15(17)19)16-12-25-18(22(16)2)21-14-7-5-4-6-8-14/h4-12,20H,3H2,1-2H3/b21-18- |
| InChIKey | XUBKOHSKLATKLW-UZYVYHOESA-N |
| XLogP | 3.94 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|