C19H20ClN3O2S2 — CID 20527243
5-[2-(2-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N,N,2-trimethylbenzenesulfonamide (PubChem CID 20527243) has the molecular formula C19H20ClN3O2S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 5-[2-(2-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 20527243 |
| Molecular Formula | C19H20ClN3O2S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 5-[2-(2-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccccc3Cl)n2C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H20ClN3O2S2/c1-13-9-10-14(11-18(13)27(24,25)22(2)3)17-12-26-19(23(17)4)21-16-8-6-5-7-15(16)20/h5-12H,1-4H3/b21-19- |
| InChIKey | ZROAPZPCICPDGT-VZCXRCSSSA-N |
| XLogP | 4.20 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|