C17H18ClN3O2S2 — CID 20527375
2-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 20527375) has the molecular formula C17H18ClN3O2S2 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 20527375 |
| Molecular Formula | C17H18ClN3O2S2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-methyl-5-(3-methyl-2-phenylimino-1,3-thiazol-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccccc3)n2C)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C17H17N3O2S2.ClH/c1-12-8-9-13(10-16(12)24(18,21)22)15-11-23-17(20(15)2)19-14-6-4-3-5-7-14;/h3-11H,1-2H3,(H2,18,21,22);1H/b19-17-; |
| InChIKey | JGHOTPJQIALNDH-HGMLFDQWSA-N |
| XLogP | 3.36 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|